About 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea
1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea (PubChem CID 111754869) has the molecular formula C17H32N4O2
and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea.
Molecular Properties
| Compound Name | 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea |
| PubChem CID | 111754869 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea |
| SMILES | CC(C)(CCO)NC(=O)Nc1cc(C(C)(C)C)nn1C(C)(C)C |
| InChI | InChI=1S/C17H32N4O2/c1-15(2,3)12-11-13(21(20-12)16(4,5)6)18-14(23)19-17(7,8)9-10-22/h11,22H,9-10H2,1-8H3,(H2,18,19,23) |
| InChIKey | GJHHIXUPAXMRIS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea?
The IUPAC name of 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea (CID 111754869) is 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea.
What is the SMILES notation for 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea?
The canonical SMILES for 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea is CC(C)(CCO)NC(=O)Nc1cc(C(C)(C)C)nn1C(C)(C)C.
What is the InChIKey of 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea?
The InChIKey is GJHHIXUPAXMRIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N4O2/c1-15(2,3)12-11-13(21(20-12)16(4,5)6)18-14(23)19-17(7,8)9-10-22/h11,22H,9-10H2,1-8H3,(H2,18,19,23).
What are the key properties of 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea?
1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea has a molecular weight of 324.47 g/mol, XLogP of 3.22, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-hydroxy-2-methylbutan-2-yl)urea is sourced from PubChem (CID 111754869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).