C21H32N4O — CID 42731468
1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-propan-2-ylphenyl)urea (PubChem CID 42731468) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 42731468 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 1-(1,3-ditert-butylpyrazol-5-yl)-3-(4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(NC(=O)Nc2cc(C(C)(C)C)nn2C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H32N4O/c1-14(2)15-9-11-16(12-10-15)22-19(26)23-18-13-17(20(3,4)5)24-25(18)21(6,7)8/h9-14H,1-8H3,(H2,22,23,26) |
| InChIKey | GGKYMXBMHFWIOZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |