C29H38N6O2 — CID 69110777
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]urea (PubChem CID 69110777) has the molecular formula C29H38N6O2 and a molecular weight of 502.66 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]urea.
| Compound Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 69110777 |
| Molecular Formula | C29H38N6O2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]urea |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(N3CCN(C(=O)C(C)C)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H38N6O2/c1-20(2)27(36)34-17-15-33(16-18-34)23-13-9-22(10-14-23)30-28(37)31-26-19-25(29(4,5)6)32-35(26)24-11-7-21(3)8-12-24/h7-14,19-20H,15-18H2,1-6H3,(H2,30,31,37) |
| InChIKey | ZBXZIUCXUSMQGJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|