C31H41N7O2 — CID 69111989
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[4-(piperidine-3-carbonyl)piperazin-1-yl]phenyl]urea (PubChem CID 69111989) has the molecular formula C31H41N7O2 and a molecular weight of 543.72 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[4-(piperidine-3-carbonyl)piperazin-1-yl]phenyl]urea.
| Compound Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[4-(piperidine-3-carbonyl)piperazin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 69111989 |
| Molecular Formula | C31H41N7O2 |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[4-(piperidine-3-carbonyl)piperazin-1-yl]phenyl]urea |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(N3CCN(C(=O)C4CCCNC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C31H41N7O2/c1-22-7-11-26(12-8-22)38-28(20-27(35-38)31(2,3)4)34-30(40)33-24-9-13-25(14-10-24)36-16-18-37(19-17-36)29(39)23-6-5-15-32-21-23/h7-14,20,23,32H,5-6,15-19,21H2,1-4H3,(H2,33,34,40) |
| InChIKey | RLXDZWNHTMOYCA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|