C17H24Cl2N4O2 — CID 111927912
N-[2-[[[2-(2,3-dichlorophenoxy)ethylamino]-(ethylamino)methylidene]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111927912) has the molecular formula C17H24Cl2N4O2 and a molecular weight of 387.31 g/mol. Its IUPAC name is N-[2-[[[2-(2,3-dichlorophenoxy)ethylamino]-(ethylamino)methylidene]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[[2-(2,3-dichlorophenoxy)ethylamino]-(ethylamino)methylidene]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111927912 |
| Molecular Formula | C17H24Cl2N4O2 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[2-[[[2-(2,3-dichlorophenoxy)ethylamino]-(ethylamino)methylidene]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCN/C(=N\CCNC(=O)C1CC1)NCCOc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H24Cl2N4O2/c1-2-20-17(22-9-8-21-16(24)12-6-7-12)23-10-11-25-14-5-3-4-13(18)15(14)19/h3-5,12H,2,6-11H2,1H3,(H,21,24)(H2,20,22,23) |
| InChIKey | QSAUCAXTIYTHPH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|