C18H28IN5O2S2 — CID 111934516
1-ethyl-2-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111934516) has the molecular formula C18H28IN5O2S2 and a molecular weight of 537.49 g/mol. Its IUPAC name is 1-ethyl-2-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111934516 |
| Molecular Formula | C18H28IN5O2S2 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.07 |
| IUPAC Name | 1-ethyl-2-[[3-(methylsulfamoylmethyl)phenyl]methyl]-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(CS(=O)(=O)NC)c1)NCCc1csc(C)n1.I |
| InChI | InChI=1S/C18H27N5O2S2.HI/c1-4-20-18(21-9-8-17-12-26-14(2)23-17)22-11-15-6-5-7-16(10-15)13-27(24,25)19-3;/h5-7,10,12,19H,4,8-9,11,13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | BCUBJVKFQJVFHG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|