C24H38N6O — CID 111936499
1-(3-ethyl-2-morpholin-4-ylpentyl)-2-methyl-3-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111936499) has the molecular formula C24H38N6O and a molecular weight of 426.61 g/mol. Its IUPAC name is 1-(3-ethyl-2-morpholin-4-ylpentyl)-2-methyl-3-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(3-ethyl-2-morpholin-4-ylpentyl)-2-methyl-3-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111936499 |
| Molecular Formula | C24H38N6O |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | 1-(3-ethyl-2-morpholin-4-ylpentyl)-2-methyl-3-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCC(CC)C(CN/C(=N\C)NCc1cccc(Cn2cccn2)c1)N1CCOCC1 |
| InChI | InChI=1S/C24H38N6O/c1-4-22(5-2)23(29-12-14-31-15-13-29)18-27-24(25-3)26-17-20-8-6-9-21(16-20)19-30-11-7-10-28-30/h6-11,16,22-23H,4-5,12-15,17-19H2,1-3H3,(H2,25,26,27) |
| InChIKey | DHJPYUPXXJIMER-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|