C24H41N5O3 — CID 111936365
2-[3-[[[N-(3-ethyl-2-morpholin-4-ylpentyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide (PubChem CID 111936365) has the molecular formula C24H41N5O3 and a molecular weight of 447.62 g/mol. Its IUPAC name is 2-[3-[[[N-(3-ethyl-2-morpholin-4-ylpentyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[3-[[[N-(3-ethyl-2-morpholin-4-ylpentyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111936365 |
| Molecular Formula | C24H41N5O3 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.32 |
| IUPAC Name | 2-[3-[[[N-(3-ethyl-2-morpholin-4-ylpentyl)-N'-methylcarbamimidoyl]amino]methyl]phenoxy]-N,N-dimethylacetamide |
| SMILES | CCC(CC)C(CN/C(=N\C)NCc1cccc(OCC(=O)N(C)C)c1)N1CCOCC1 |
| InChI | InChI=1S/C24H41N5O3/c1-6-20(7-2)22(29-11-13-31-14-12-29)17-27-24(25-3)26-16-19-9-8-10-21(15-19)32-18-23(30)28(4)5/h8-10,15,20,22H,6-7,11-14,16-18H2,1-5H3,(H2,25,26,27) |
| InChIKey | SPFTZRRRJKGQAS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|