C20H28IN3O2S — CID 111938124
1-[(2,4-dimethylphenyl)methyl]-3-ethyl-2-[(4-methylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111938124) has the molecular formula C20H28IN3O2S and a molecular weight of 501.43 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl]-3-ethyl-2-[(4-methylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,4-dimethylphenyl)methyl]-3-ethyl-2-[(4-methylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111938124 |
| Molecular Formula | C20H28IN3O2S |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methyl]-3-ethyl-2-[(4-methylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(C)(=O)=O)cc1)NCc1ccc(C)cc1C.I |
| InChI | InChI=1S/C20H27N3O2S.HI/c1-5-21-20(23-14-18-9-6-15(2)12-16(18)3)22-13-17-7-10-19(11-8-17)26(4,24)25;/h6-12H,5,13-14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | VMCXSPKKZRWSDR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|