C15H27IN4S — CID 111941144
1-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111941144) has the molecular formula C15H27IN4S and a molecular weight of 422.38 g/mol. Its IUPAC name is 1-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111941144 |
| Molecular Formula | C15H27IN4S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCN(C(C)C)C1CC1)NCc1ccsc1.I |
| InChI | InChI=1S/C15H26N4S.HI/c1-12(2)19(14-4-5-14)8-7-17-15(16-3)18-10-13-6-9-20-11-13;/h6,9,11-12,14H,4-5,7-8,10H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | LXULAJPIYCMNJQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|