C16H32N4O3 — CID 111941501
propan-2-yl 3-[[[[3-(diethylamino)-3-oxopropyl]amino]-(ethylamino)methylidene]amino]propanoate (PubChem CID 111941501) has the molecular formula C16H32N4O3 and a molecular weight of 328.46 g/mol. Its IUPAC name is propan-2-yl 3-[[[[3-(diethylamino)-3-oxopropyl]amino]-(ethylamino)methylidene]amino]propanoate.
| Compound Name | propan-2-yl 3-[[[[3-(diethylamino)-3-oxopropyl]amino]-(ethylamino)methylidene]amino]propanoate |
|---|---|
| PubChem CID | 111941501 |
| Molecular Formula | C16H32N4O3 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | propan-2-yl 3-[[[[3-(diethylamino)-3-oxopropyl]amino]-(ethylamino)methylidene]amino]propanoate |
| SMILES | CCN/C(=N\CCC(=O)OC(C)C)NCCC(=O)N(CC)CC |
| InChI | InChI=1S/C16H32N4O3/c1-6-17-16(19-12-10-15(22)23-13(4)5)18-11-9-14(21)20(7-2)8-3/h13H,6-12H2,1-5H3,(H2,17,18,19) |
| InChIKey | DHERTKXJSPXQIV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|