C18H39N5O — CID 111942097
3-[[N'-[4-(diethylamino)butyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide (PubChem CID 111942097) has the molecular formula C18H39N5O and a molecular weight of 341.54 g/mol. Its IUPAC name is 3-[[N'-[4-(diethylamino)butyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide.
| Compound Name | 3-[[N'-[4-(diethylamino)butyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 111942097 |
| Molecular Formula | C18H39N5O |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.32 |
| IUPAC Name | 3-[[N'-[4-(diethylamino)butyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide |
| SMILES | CCN/C(=N\CCCCN(CC)CC)NCCC(=O)N(CC)CC |
| InChI | InChI=1S/C18H39N5O/c1-6-19-18(20-14-11-12-16-22(7-2)8-3)21-15-13-17(24)23(9-4)10-5/h6-16H2,1-5H3,(H2,19,20,21) |
| InChIKey | PFFLQIAYAQSOBM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|