C69H60Br6 — CID 11194215
CID 11194215 (PubChem CID 11194215) has the molecular formula C69H60Br6 and a molecular weight of 1368.66 g/mol.
| Compound Name | CID 11194215 |
|---|---|
| PubChem CID | 11194215 |
| Molecular Formula | C69H60Br6 |
| Molecular Weight | 1368.66 g/mol |
| Exact Mass | 1361.98 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1[C]c1c(Br)cc(C#Cc2cc(C#Cc3cc(Br)c([C]c4c(C)cc(C(C)(C)C)cc4C)c(Br)c3)cc(C#Cc3cc(Br)c([C]c4c(C)cc(C(C)(C)C)cc4C)c(Br)c3)c2)cc1Br |
| InChI | InChI=1S/C69H60Br6/c1-40-22-52(67(7,8)9)23-41(2)55(40)37-58-61(70)31-49(32-62(58)71)19-16-46-28-47(17-20-50-33-63(72)59(64(73)34-50)38-56-42(3)24-53(25-43(56)4)68(10,11)12)30-48(29-46)18-21-51-35-65(74)60(66(75)36-51)39-57-44(5)26-54(27-45(57)6)69(13,14)15/h22-36H,1-15H3 |
| InChIKey | DGLRAOTXTJFFQW-UHFFFAOYSA-N |
| XLogP | 20.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1368.66 |
| LogP ≤ 5 | 20.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|