C7H11N3 — CID 11194367
2-N,6-N-dimethylpyridine-2,6-diamine (PubChem CID 11194367) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 2-N,6-N-dimethylpyridine-2,6-diamine.
| Compound Name | 2-N,6-N-dimethylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 11194367 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 2-N,6-N-dimethylpyridine-2,6-diamine |
| SMILES | CNc1cccc(NC)n1 |
| InChI | InChI=1S/C7H11N3/c1-8-6-4-3-5-7(9-2)10-6/h3-5H,1-2H3,(H2,8,9,10) |
| InChIKey | YWLKXMKIKWXYSQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |