C23H40N4O — CID 111945853
1-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-3-(4-ethoxybutyl)-2-methylguanidine (PubChem CID 111945853) has the molecular formula C23H40N4O and a molecular weight of 388.60 g/mol. Its IUPAC name is 1-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-3-(4-ethoxybutyl)-2-methylguanidine.
| Compound Name | 1-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-3-(4-ethoxybutyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111945853 |
| Molecular Formula | C23H40N4O |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | 1-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-3-(4-ethoxybutyl)-2-methylguanidine |
| SMILES | CCOCCCCN/C(=N\C)NCc1ccc(CN2CC(C)CC(C)C2)cc1 |
| InChI | InChI=1S/C23H40N4O/c1-5-28-13-7-6-12-25-23(24-4)26-15-21-8-10-22(11-9-21)18-27-16-19(2)14-20(3)17-27/h8-11,19-20H,5-7,12-18H2,1-4H3,(H2,24,25,26) |
| InChIKey | NPFUKUPYGKBUPQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|