C9H15N3O — CID 11194684
1-amino-N-(cyanomethyl)cyclohexane-1-carboxamide (PubChem CID 11194684) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-amino-N-(cyanomethyl)cyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-(cyanomethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11194684 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 1-amino-N-(cyanomethyl)cyclohexane-1-carboxamide |
| SMILES | N#CCNC(=O)C1(N)CCCCC1 |
| InChI | InChI=1S/C9H15N3O/c10-6-7-12-8(13)9(11)4-2-1-3-5-9/h1-5,7,11H2,(H,12,13) |
| InChIKey | RUWBBBUXZRUXBG-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|