C19H35IN4 — CID 111947772
2-[2-(dimethylamino)-2-methylpropyl]-1-ethyl-3-(2-methyl-2-phenylpropyl)guanidine;hydroiodide (PubChem CID 111947772) has the molecular formula C19H35IN4 and a molecular weight of 446.42 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-methylpropyl]-1-ethyl-3-(2-methyl-2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(dimethylamino)-2-methylpropyl]-1-ethyl-3-(2-methyl-2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111947772 |
| Molecular Formula | C19H35IN4 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-[2-(dimethylamino)-2-methylpropyl]-1-ethyl-3-(2-methyl-2-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)N(C)C)NCC(C)(C)c1ccccc1.I |
| InChI | InChI=1S/C19H34N4.HI/c1-8-20-17(22-15-19(4,5)23(6)7)21-14-18(2,3)16-12-10-9-11-13-16;/h9-13H,8,14-15H2,1-7H3,(H2,20,21,22);1H |
| InChIKey | JQCIWZYEJHCWHF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|