C26H36N4O2 — CID 111948309
1-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-2-methyl-3-(2-methyl-2-phenylpropyl)guanidine (PubChem CID 111948309) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 1-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-2-methyl-3-(2-methyl-2-phenylpropyl)guanidine.
| Compound Name | 1-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-2-methyl-3-(2-methyl-2-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 111948309 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 1-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-2-methyl-3-(2-methyl-2-phenylpropyl)guanidine |
| SMILES | C/N=C(/NCc1ccc(C(=O)N2CC(C)OC(C)C2)cc1)NCC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C26H36N4O2/c1-19-16-30(17-20(2)32-19)24(31)22-13-11-21(12-14-22)15-28-25(27-5)29-18-26(3,4)23-9-7-6-8-10-23/h6-14,19-20H,15-18H2,1-5H3,(H2,27,28,29) |
| InChIKey | JLKSCILSUSLWGW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|