C25H35IN4O — CID 111948102
2-methyl-1-(2-methyl-2-phenylpropyl)-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111948102) has the molecular formula C25H35IN4O and a molecular weight of 534.49 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-phenylpropyl)-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methyl-2-phenylpropyl)-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111948102 |
| Molecular Formula | C25H35IN4O |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-phenylpropyl)-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(C(=O)N2CCCCC2)cc1)NCC(C)(C)c1ccccc1.I |
| InChI | InChI=1S/C25H34N4O.HI/c1-25(2,22-10-6-4-7-11-22)19-28-24(26-3)27-18-20-12-14-21(15-13-20)23(30)29-16-8-5-9-17-29;/h4,6-7,10-15H,5,8-9,16-19H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | WHCNIFNPOUHDNC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|