C22H29IN4O — CID 110953717
1-benzyl-2-methyl-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110953717) has the molecular formula C22H29IN4O and a molecular weight of 492.41 g/mol. Its IUPAC name is 1-benzyl-2-methyl-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-benzyl-2-methyl-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110953717 |
| Molecular Formula | C22H29IN4O |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 1-benzyl-2-methyl-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1)NCc1ccc(C(=O)N2CCCCC2)cc1.I |
| InChI | InChI=1S/C22H28N4O.HI/c1-23-22(24-16-18-8-4-2-5-9-18)25-17-19-10-12-20(13-11-19)21(27)26-14-6-3-7-15-26;/h2,4-5,8-13H,3,6-7,14-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | XPHMCGYVIUBURR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|