C18H26F3IN4O — CID 109471814
2-methyl-1-[[4-(piperidine-1-carbonyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109471814) has the molecular formula C18H26F3IN4O and a molecular weight of 498.33 g/mol. Its IUPAC name is 2-methyl-1-[[4-(piperidine-1-carbonyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-(piperidine-1-carbonyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109471814 |
| Molecular Formula | C18H26F3IN4O |
| Molecular Weight | 498.33 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 2-methyl-1-[[4-(piperidine-1-carbonyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1ccc(C(=O)N2CCCCC2)cc1.I |
| InChI | InChI=1S/C18H25F3N4O.HI/c1-22-17(23-10-9-18(19,20)21)24-13-14-5-7-15(8-6-14)16(26)25-11-3-2-4-12-25;/h5-8H,2-4,9-13H2,1H3,(H2,22,23,24);1H |
| InChIKey | CKKATFMXWVDLQF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|