C23H30ClIN4O — CID 111358083
1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111358083) has the molecular formula C23H30ClIN4O and a molecular weight of 540.88 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111358083 |
| Molecular Formula | C23H30ClIN4O |
| Molecular Weight | 540.88 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-2-methyl-3-[[4-(piperidine-1-carbonyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1cccc(Cl)c1)NCc1ccc(C(=O)N2CCCCC2)cc1.I |
| InChI | InChI=1S/C23H29ClN4O.HI/c1-25-23(26-13-12-18-6-5-7-21(24)16-18)27-17-19-8-10-20(11-9-19)22(29)28-14-3-2-4-15-28;/h5-11,16H,2-4,12-15,17H2,1H3,(H2,25,26,27);1H |
| InChIKey | LUPJBCSHGDYZQU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|