C18H25F3N4O — CID 109465286
2-methyl-1-[[3-(piperidine-1-carbonyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109465286) has the molecular formula C18H25F3N4O and a molecular weight of 370.42 g/mol. Its IUPAC name is 2-methyl-1-[[3-(piperidine-1-carbonyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-[[3-(piperidine-1-carbonyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109465286 |
| Molecular Formula | C18H25F3N4O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-methyl-1-[[3-(piperidine-1-carbonyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1cccc(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C18H25F3N4O/c1-22-17(23-9-8-18(19,20)21)24-13-14-6-5-7-15(12-14)16(26)25-10-3-2-4-11-25/h5-7,12H,2-4,8-11,13H2,1H3,(H2,22,23,24) |
| InChIKey | ZKLMQKNIKRAMHQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|