C21H25ClN4O2 — CID 111948831
2-chloro-N-[2-[[N'-(2,3-dihydro-1-benzofuran-2-ylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]benzamide (PubChem CID 111948831) has the molecular formula C21H25ClN4O2 and a molecular weight of 400.91 g/mol. Its IUPAC name is 2-chloro-N-[2-[[N'-(2,3-dihydro-1-benzofuran-2-ylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[N'-(2,3-dihydro-1-benzofuran-2-ylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111948831 |
| Molecular Formula | C21H25ClN4O2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-chloro-N-[2-[[N'-(2,3-dihydro-1-benzofuran-2-ylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\CC1Cc2ccccc2O1)NCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C21H25ClN4O2/c1-2-23-21(26-14-16-13-15-7-3-6-10-19(15)28-16)25-12-11-24-20(27)17-8-4-5-9-18(17)22/h3-10,16H,2,11-14H2,1H3,(H,24,27)(H2,23,25,26) |
| InChIKey | MPMNCYSNKYRSAZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|