C17H28N4O3S — CID 111950221
2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine (PubChem CID 111950221) has the molecular formula C17H28N4O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine |
|---|---|
| PubChem CID | 111950221 |
| Molecular Formula | C17H28N4O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-ethyl-3-[3-(ethylsulfonylamino)propyl]guanidine |
| SMILES | CCN/C(=N\CC1Cc2ccccc2O1)NCCCNS(=O)(=O)CC |
| InChI | InChI=1S/C17H28N4O3S/c1-3-18-17(19-10-7-11-21-25(22,23)4-2)20-13-15-12-14-8-5-6-9-16(14)24-15/h5-6,8-9,15,21H,3-4,7,10-13H2,1-2H3,(H2,18,19,20) |
| InChIKey | WGUBPMXBOONKHH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|