C19H27N5O — CID 111949153
2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine (PubChem CID 111949153) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111949153 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-ethyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC1Cc2ccccc2O1)NCCCc1cn[nH]c1C |
| InChI | InChI=1S/C19H27N5O/c1-3-20-19(21-10-6-8-16-12-23-24-14(16)2)22-13-17-11-15-7-4-5-9-18(15)25-17/h4-5,7,9,12,17H,3,6,8,10-11,13H2,1-2H3,(H,23,24)(H2,20,21,22) |
| InChIKey | SVGDFDUEZBWMNH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|