C19H24N4O3 — CID 111948981
2-[[(2,3-dihydro-1-benzofuran-2-ylmethylamino)-(ethylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 111948981) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-[[(2,3-dihydro-1-benzofuran-2-ylmethylamino)-(ethylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[(2,3-dihydro-1-benzofuran-2-ylmethylamino)-(ethylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 111948981 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 2-[[(2,3-dihydro-1-benzofuran-2-ylmethylamino)-(ethylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)NCc1ccco1)NCC1Cc2ccccc2O1 |
| InChI | InChI=1S/C19H24N4O3/c1-2-20-19(23-13-18(24)21-11-15-7-5-9-25-15)22-12-16-10-14-6-3-4-8-17(14)26-16/h3-9,16H,2,10-13H2,1H3,(H,21,24)(H2,20,22,23) |
| InChIKey | YJJPBQUYUWYZCS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|