C17H24IN5O — CID 111949114
2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-ethyl-3-(2-imidazol-1-ylethyl)guanidine;hydroiodide (PubChem CID 111949114) has the molecular formula C17H24IN5O and a molecular weight of 441.32 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-ethyl-3-(2-imidazol-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-ethyl-3-(2-imidazol-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111949114 |
| Molecular Formula | C17H24IN5O |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-ethyl-3-(2-imidazol-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1Cc2ccccc2O1)NCCn1ccnc1.I |
| InChI | InChI=1S/C17H23N5O.HI/c1-2-19-17(20-8-10-22-9-7-18-13-22)21-12-15-11-14-5-3-4-6-16(14)23-15;/h3-7,9,13,15H,2,8,10-12H2,1H3,(H2,19,20,21);1H |
| InChIKey | IAHBOIBFBHXUPG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|