C15H28N6O2 — CID 111950659
2-[[N-ethyl-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 111950659) has the molecular formula C15H28N6O2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[N-ethyl-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111950659 |
| Molecular Formula | C15H28N6O2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 2-[[N-ethyl-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN/C(=N\Cc1c(C)nn(C)c1C)NCC(=O)NCCOC |
| InChI | InChI=1S/C15H28N6O2/c1-6-16-15(19-10-14(22)17-7-8-23-5)18-9-13-11(2)20-21(4)12(13)3/h6-10H2,1-5H3,(H,17,22)(H2,16,18,19) |
| InChIKey | AVWLHTNREONJGP-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|