C21H31IN6O — CID 111950686
2-methyl-1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111950686) has the molecular formula C21H31IN6O and a molecular weight of 510.42 g/mol. Its IUPAC name is 2-methyl-1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111950686 |
| Molecular Formula | C21H31IN6O |
| Molecular Weight | 510.42 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 2-methyl-1-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(CN2CCCC2=O)c1)NCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C21H30N6O.HI/c1-15-19(16(2)26(4)25-15)13-24-21(22-3)23-12-17-7-5-8-18(11-17)14-27-10-6-9-20(27)28;/h5,7-8,11H,6,9-10,12-14H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | WTULVUQUNJRDLE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|