C23H38IN7 — CID 111951164
2-methyl-1-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111951164) has the molecular formula C23H38IN7 and a molecular weight of 539.51 g/mol. Its IUPAC name is 2-methyl-1-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111951164 |
| Molecular Formula | C23H38IN7 |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 2-methyl-1-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCN(C)CC1c1ccccc1)NCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C23H37N7.HI/c1-18-21(19(2)29(5)27-18)16-26-23(24-3)25-12-9-13-30-15-14-28(4)17-22(30)20-10-7-6-8-11-20;/h6-8,10-11,22H,9,12-17H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | FCYVRHZLMUBIRE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|