C25H31N7 — CID 111952055
2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-ethyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111952055) has the molecular formula C25H31N7 and a molecular weight of 429.57 g/mol. Its IUPAC name is 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-ethyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-ethyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111952055 |
| Molecular Formula | C25H31N7 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 2-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-1-ethyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cn2cnc3ccccc32)cc1)NCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C25H31N7/c1-5-26-25(28-15-22-18(2)30-31(4)19(22)3)27-14-20-10-12-21(13-11-20)16-32-17-29-23-8-6-7-9-24(23)32/h6-13,17H,5,14-16H2,1-4H3,(H2,26,27,28) |
| InChIKey | BYXORFHCAUYQAY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|