C24H33IN6O2 — CID 111953194
2-methyl-1-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111953194) has the molecular formula C24H33IN6O2 and a molecular weight of 564.47 g/mol. Its IUPAC name is 2-methyl-1-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111953194 |
| Molecular Formula | C24H33IN6O2 |
| Molecular Weight | 564.47 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 2-methyl-1-[[2-(4-propoxyphenoxy)-3-pyridinyl]methyl]-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCCOc1ccc(Oc2ncccc2CN/C(=N/C)NCc2c(C)nn(C)c2C)cc1.I |
| InChI | InChI=1S/C24H32N6O2.HI/c1-6-14-31-20-9-11-21(12-10-20)32-23-19(8-7-13-26-23)15-27-24(25-4)28-16-22-17(2)29-30(5)18(22)3;/h7-13H,6,14-16H2,1-5H3,(H2,25,27,28);1H |
| InChIKey | ZNUJSXBXOWSOOR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|