C20H27N7 — CID 111953445
1-[2-(1-benzylimidazol-2-yl)ethyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine (PubChem CID 111953445) has the molecular formula C20H27N7 and a molecular weight of 365.49 g/mol. Its IUPAC name is 1-[2-(1-benzylimidazol-2-yl)ethyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-[2-(1-benzylimidazol-2-yl)ethyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111953445 |
| Molecular Formula | C20H27N7 |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | 1-[2-(1-benzylimidazol-2-yl)ethyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCCc1nccn1Cc1ccccc1 |
| InChI | InChI=1S/C20H27N7/c1-3-21-20(24-15-18-9-12-25-26(18)2)23-11-10-19-22-13-14-27(19)16-17-7-5-4-6-8-17/h4-9,12-14H,3,10-11,15-16H2,1-2H3,(H2,21,23,24) |
| InChIKey | KTHPSAXYRRRWBC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|