C21H34IN7 — CID 111955892
1-[2-(4-benzylpiperazin-1-yl)ethyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111955892) has the molecular formula C21H34IN7 and a molecular weight of 511.46 g/mol. Its IUPAC name is 1-[2-(4-benzylpiperazin-1-yl)ethyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-benzylpiperazin-1-yl)ethyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111955892 |
| Molecular Formula | C21H34IN7 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 1-[2-(4-benzylpiperazin-1-yl)ethyl]-3-ethyl-2-[(2-methylpyrazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnn1C)NCCN1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C21H33N7.HI/c1-3-22-21(24-17-20-9-10-25-26(20)2)23-11-12-27-13-15-28(16-14-27)18-19-7-5-4-6-8-19;/h4-10H,3,11-18H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | BRUMNWNTZCRVGB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|