C11H20O5 — CID 11195627
(3R,4S,5S)-4,5-bis(methoxymethoxy)hepta-1,6-dien-3-ol (PubChem CID 11195627) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is (3R,4S,5S)-4,5-bis(methoxymethoxy)hepta-1,6-dien-3-ol.
| Compound Name | (3R,4S,5S)-4,5-bis(methoxymethoxy)hepta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 11195627 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (3R,4S,5S)-4,5-bis(methoxymethoxy)hepta-1,6-dien-3-ol |
| SMILES | C=C[C@@H](O)[C@H](OCOC)[C@H](C=C)OCOC |
| InChI | InChI=1S/C11H20O5/c1-5-9(12)11(16-8-14-4)10(6-2)15-7-13-3/h5-6,9-12H,1-2,7-8H2,3-4H3/t9-,10+,11+/m1/s1 |
| InChIKey | IMSSXRHLYLQPHU-VWYCJHECSA-N |
| XLogP | 0.70 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|