C9H18O4 — CID 11424055
(2S,3S)-3-(2-methoxyethoxymethoxy)pent-4-en-2-ol (PubChem CID 11424055) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is (2S,3S)-3-(2-methoxyethoxymethoxy)pent-4-en-2-ol.
| Compound Name | (2S,3S)-3-(2-methoxyethoxymethoxy)pent-4-en-2-ol |
|---|---|
| PubChem CID | 11424055 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (2S,3S)-3-(2-methoxyethoxymethoxy)pent-4-en-2-ol |
| SMILES | C=C[C@H](OCOCCOC)[C@H](C)O |
| InChI | InChI=1S/C9H18O4/c1-4-9(8(2)10)13-7-12-6-5-11-3/h4,8-10H,1,5-7H2,2-3H3/t8-,9-/m0/s1 |
| InChIKey | ZUDYAQBKNXXWSP-IUCAKERBSA-N |
| XLogP | 0.56 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|