C9H16O3 — CID 13025036
(5E)-3-(methoxymethoxy)hepta-1,5-dien-4-ol (PubChem CID 13025036) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (5E)-3-(methoxymethoxy)hepta-1,5-dien-4-ol.
| Compound Name | (5E)-3-(methoxymethoxy)hepta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 13025036 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (5E)-3-(methoxymethoxy)hepta-1,5-dien-4-ol |
| SMILES | C=CC(OCOC)C(O)/C=C/C |
| InChI | InChI=1S/C9H16O3/c1-4-6-8(10)9(5-2)12-7-11-3/h4-6,8-10H,2,7H2,1,3H3/b6-4+ |
| InChIKey | GWEIBBSDCYQLLW-GQCTYLIASA-N |
| XLogP | 1.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|