C16H25N3O2S — CID 111961097
1-(3-benzylsulfonylpropyl)-2-methyl-3-(2-methylcyclopropyl)guanidine (PubChem CID 111961097) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 1-(3-benzylsulfonylpropyl)-2-methyl-3-(2-methylcyclopropyl)guanidine.
| Compound Name | 1-(3-benzylsulfonylpropyl)-2-methyl-3-(2-methylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 111961097 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-(3-benzylsulfonylpropyl)-2-methyl-3-(2-methylcyclopropyl)guanidine |
| SMILES | C/N=C(\NCCCS(=O)(=O)Cc1ccccc1)NC1CC1C |
| InChI | InChI=1S/C16H25N3O2S/c1-13-11-15(13)19-16(17-2)18-9-6-10-22(20,21)12-14-7-4-3-5-8-14/h3-5,7-8,13,15H,6,9-12H2,1-2H3,(H2,17,18,19) |
| InChIKey | KABCQVXRWDRMDV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|