C18H29N3O2 — CID 111961199
2-[3-(3,4-dimethoxyphenyl)propyl]-1-ethyl-3-(2-methylcyclopropyl)guanidine (PubChem CID 111961199) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[3-(3,4-dimethoxyphenyl)propyl]-1-ethyl-3-(2-methylcyclopropyl)guanidine.
| Compound Name | 2-[3-(3,4-dimethoxyphenyl)propyl]-1-ethyl-3-(2-methylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 111961199 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 2-[3-(3,4-dimethoxyphenyl)propyl]-1-ethyl-3-(2-methylcyclopropyl)guanidine |
| SMILES | CCN/C(=N\CCCc1ccc(OC)c(OC)c1)NC1CC1C |
| InChI | InChI=1S/C18H29N3O2/c1-5-19-18(21-15-11-13(15)2)20-10-6-7-14-8-9-16(22-3)17(12-14)23-4/h8-9,12-13,15H,5-7,10-11H2,1-4H3,(H2,19,20,21) |
| InChIKey | PXTTYJNPTZIUBB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|