C15H27N5O — CID 111964839
1-ethyl-2-(1,2-oxazol-3-ylmethyl)-3-(1-propan-2-ylpiperidin-4-yl)guanidine (PubChem CID 111964839) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-ethyl-2-(1,2-oxazol-3-ylmethyl)-3-(1-propan-2-ylpiperidin-4-yl)guanidine.
| Compound Name | 1-ethyl-2-(1,2-oxazol-3-ylmethyl)-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111964839 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 1-ethyl-2-(1,2-oxazol-3-ylmethyl)-3-(1-propan-2-ylpiperidin-4-yl)guanidine |
| SMILES | CCN/C(=N\Cc1ccon1)NC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C15H27N5O/c1-4-16-15(17-11-14-7-10-21-19-14)18-13-5-8-20(9-6-13)12(2)3/h7,10,12-13H,4-6,8-9,11H2,1-3H3,(H2,16,17,18) |
| InChIKey | YYGMTOCVGBFSLA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|