C19H27N5O — CID 111964887
1-ethyl-2-(1,2-oxazol-3-ylmethyl)-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111964887) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-ethyl-2-(1,2-oxazol-3-ylmethyl)-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-(1,2-oxazol-3-ylmethyl)-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111964887 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 1-ethyl-2-(1,2-oxazol-3-ylmethyl)-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccon1)NCC(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C19H27N5O/c1-2-20-19(21-14-17-10-13-25-23-17)22-15-18(24-11-6-7-12-24)16-8-4-3-5-9-16/h3-5,8-10,13,18H,2,6-7,11-12,14-15H2,1H3,(H2,20,21,22) |
| InChIKey | WMGDOKRNWBWJRV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|