C22H36FN5O3 — CID 111968977
2-[[[2-(2-fluorophenoxy)butylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111968977) has the molecular formula C22H36FN5O3 and a molecular weight of 437.56 g/mol. Its IUPAC name is 2-[[[2-(2-fluorophenoxy)butylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(2-fluorophenoxy)butylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111968977 |
| Molecular Formula | C22H36FN5O3 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 2-[[[2-(2-fluorophenoxy)butylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCC(CN/C(=N/CC(=O)N(C)C)NCCCN1CCOCC1)Oc1ccccc1F |
| InChI | InChI=1S/C22H36FN5O3/c1-4-18(31-20-9-6-5-8-19(20)23)16-25-22(26-17-21(29)27(2)3)24-10-7-11-28-12-14-30-15-13-28/h5-6,8-9,18H,4,7,10-17H2,1-3H3,(H2,24,25,26) |
| InChIKey | QNRXREXXVRGZMA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|