C17H19N3O2 — CID 111969344
1-(furan-2-yl)-2-[(2-methyl-3-phenylimidazol-4-yl)methylamino]ethanol (PubChem CID 111969344) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[(2-methyl-3-phenylimidazol-4-yl)methylamino]ethanol.
| Compound Name | 1-(furan-2-yl)-2-[(2-methyl-3-phenylimidazol-4-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 111969344 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-(furan-2-yl)-2-[(2-methyl-3-phenylimidazol-4-yl)methylamino]ethanol |
| SMILES | Cc1ncc(CNCC(O)c2ccco2)n1-c1ccccc1 |
| InChI | InChI=1S/C17H19N3O2/c1-13-19-11-15(20(13)14-6-3-2-4-7-14)10-18-12-16(21)17-8-5-9-22-17/h2-9,11,16,18,21H,10,12H2,1H3 |
| InChIKey | PMDQYCDOUYQUCY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |