About S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate
S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate (PubChem CID 111969520) has the molecular formula C15H24N2O2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate.
Molecular Properties
| Compound Name | S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate |
| PubChem CID | 111969520 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(Cc1ccc(SC(=O)N(C)C)cc1)CC(C)(C)O |
| InChI | InChI=1S/C15H24N2O2S/c1-15(2,19)11-17(5)10-12-6-8-13(9-7-12)20-14(18)16(3)4/h6-9,19H,10-11H2,1-5H3 |
| InChIKey | MKKYCHQOVKELCW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate?
The IUPAC name of S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate (CID 111969520) is S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate.
What is the SMILES notation for S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate?
The canonical SMILES for S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate is CN(Cc1ccc(SC(=O)N(C)C)cc1)CC(C)(C)O.
What is the InChIKey of S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate?
The InChIKey is MKKYCHQOVKELCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2S/c1-15(2,19)11-17(5)10-12-6-8-13(9-7-12)20-14(18)16(3)4/h6-9,19H,10-11H2,1-5H3.
What are the key properties of S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate?
S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate has a molecular weight of 296.44 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[4-[[(2-hydroxy-2-methylpropyl)-methylamino]methyl]phenyl] N,N-dimethylcarbamothioate is sourced from PubChem (CID 111969520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).