C17H16ClNO2S — CID 18786415
S-[4-[4-(2-chloroacetyl)phenyl]phenyl] N,N-dimethylcarbamothioate (PubChem CID 18786415) has the molecular formula C17H16ClNO2S and a molecular weight of 333.84 g/mol. Its IUPAC name is S-[4-[4-(2-chloroacetyl)phenyl]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[4-(2-chloroacetyl)phenyl]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 18786415 |
| Molecular Formula | C17H16ClNO2S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | S-[4-[4-(2-chloroacetyl)phenyl]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(-c2ccc(C(=O)CCl)cc2)cc1 |
| InChI | InChI=1S/C17H16ClNO2S/c1-19(2)17(21)22-15-9-7-13(8-10-15)12-3-5-14(6-4-12)16(20)11-18/h3-10H,11H2,1-2H3 |
| InChIKey | KSRYBRJUAQUPIA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|