C28H42N2O2+2 — CID 90476113
triethyl-[2-oxo-2-[4-[4-[2-(triethylazaniumyl)acetyl]phenyl]phenyl]ethyl]azanium (PubChem CID 90476113) has the molecular formula C28H42N2O2+2 and a molecular weight of 438.66 g/mol. Its IUPAC name is triethyl-[2-oxo-2-[4-[4-[2-(triethylazaniumyl)acetyl]phenyl]phenyl]ethyl]azanium.
| Compound Name | triethyl-[2-oxo-2-[4-[4-[2-(triethylazaniumyl)acetyl]phenyl]phenyl]ethyl]azanium |
|---|---|
| PubChem CID | 90476113 |
| Molecular Formula | C28H42N2O2+2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | triethyl-[2-oxo-2-[4-[4-[2-(triethylazaniumyl)acetyl]phenyl]phenyl]ethyl]azanium |
| SMILES | CC[N+](CC)(CC)CC(=O)c1ccc(-c2ccc(C(=O)C[N+](CC)(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C28H42N2O2/c1-7-29(8-2,9-3)21-27(31)25-17-13-23(14-18-25)24-15-19-26(20-16-24)28(32)22-30(10-4,11-5)12-6/h13-20H,7-12,21-22H2,1-6H3/q+2 |
| InChIKey | GAYDRQYRMVTGBT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|