C21H23BrClNO — CID 146050956
[2-(4-chlorophenyl)-2-oxoethyl]-diethyl-(3-phenylprop-2-ynyl)azanium bromide (PubChem CID 146050956) has the molecular formula C21H23BrClNO and a molecular weight of 420.78 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl]-diethyl-(3-phenylprop-2-ynyl)azanium bromide.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl]-diethyl-(3-phenylprop-2-ynyl)azanium bromide |
|---|---|
| PubChem CID | 146050956 |
| Molecular Formula | C21H23BrClNO |
| Molecular Weight | 420.78 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl]-diethyl-(3-phenylprop-2-ynyl)azanium bromide |
| SMILES | CC[N+](CC)(CC#Cc1ccccc1)CC(=O)c1ccc(Cl)cc1.[Br-] |
| InChI | InChI=1S/C21H23ClNO.BrH/c1-3-23(4-2,16-8-11-18-9-6-5-7-10-18)17-21(24)19-12-14-20(22)15-13-19;/h5-7,9-10,12-15H,3-4,16-17H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | KNQOPHFEHWGNIG-UHFFFAOYSA-M |
| XLogP | 1.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.78 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|