C17H14ClNO — CID 51325787
2-(4-chlorophenyl)-N-(3-phenylprop-2-ynyl)acetamide (PubChem CID 51325787) has the molecular formula C17H14ClNO and a molecular weight of 283.76 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(3-phenylprop-2-ynyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-(3-phenylprop-2-ynyl)acetamide |
|---|---|
| PubChem CID | 51325787 |
| Molecular Formula | C17H14ClNO |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(3-phenylprop-2-ynyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCC#Cc1ccccc1 |
| InChI | InChI=1S/C17H14ClNO/c18-16-10-8-15(9-11-16)13-17(20)19-12-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-11H,12-13H2,(H,19,20) |
| InChIKey | IQBQWQWZAGSTBJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|