About benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene
benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene (PubChem CID 175437974) has the molecular formula C23H19ClO2S2
and a molecular weight of 426.99 g/mol. Its IUPAC name is benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene.
Molecular Properties
| Compound Name | benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene |
| PubChem CID | 175437974 |
| Molecular Formula | C23H19ClO2S2 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene |
| SMILES | CC#Cc1ccccc1.O=C(S)c1ccc(Cl)cc1.O=C(S)c1ccccc1 |
| InChI | InChI=1S/C9H8.C7H5ClOS.C7H6OS/c1-2-6-9-7-4-3-5-8-9;8-6-3-1-5(2-4-6)7(9)10;8-7(9)6-4-2-1-3-5-6/h3-5,7-8H,1H3;1-4H,(H,9,10);1-5H,(H,8,9) |
| InChIKey | ZAJFEOCCNZCPKK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene?
The IUPAC name of benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene (CID 175437974) is benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene.
What is the SMILES notation for benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene?
The canonical SMILES for benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene is CC#Cc1ccccc1.O=C(S)c1ccc(Cl)cc1.O=C(S)c1ccccc1.
What is the InChIKey of benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene?
The InChIKey is ZAJFEOCCNZCPKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.C7H5ClOS.C7H6OS/c1-2-6-9-7-4-3-5-8-9;8-6-3-1-5(2-4-6)7(9)10;8-7(9)6-4-2-1-3-5-6/h3-5,7-8H,1H3;1-4H,(H,9,10);1-5H,(H,8,9).
What are the key properties of benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene?
benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene has a molecular weight of 426.99 g/mol, XLogP of 6.22, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarbothioic S-acid;4-chlorobenzenecarbothioic S-acid;prop-1-ynylbenzene is sourced from PubChem (CID 175437974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).